583-57-3 1,2-Dimethylcyclohexane
Название продукта |
1,2-Dimethylcyclohexane |
Английское название |
1,2-Dimethylcyclohexane; 1,2-Dimethylcyclohexane (cis+trans); (1R,2R)-1,2-dimethylcyclohexane |
Молекулярная формула |
C8H16 |
Молекулярный вес |
112.2126 |
InChI |
InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
Регистрационный номер CAS |
583-57-3 |
EINECS |
209-509-4 |
Молекулярная структура |
|
Плотность |
0.766g/cm3 |
Точка кипения |
125.9°C at 760 mmHg |
Показатель преломления |
1.42 |
Температура вспышки |
15.6°C |
Давление пара |
14.5mmHg at 25°C |
Символы опасности |
F:Highly flammable;
|
Риск коды |
R11:Highly flammable.;
R38:Irritating to skin.;
|
Характеристики безопасности |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|