ChemNet > CAS > 60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
| Название продукта |
3,4-Dimethoxyphenylacetic acid hydrazide |
| Английское название |
3,4-Dimethoxyphenylacetic acid hydrazide; 3,4-Dimethoxyphenylacethydrazide~Homoveratric acid hydrazide; 2-(3,4-dimethoxyphenyl)acetohydrazide |
| Молекулярная формула |
C10H14N2O3 |
| Молекулярный вес |
210.2298 |
| InChI |
InChI=1/C10H14N2O3/c1-14-8-4-3-7(5-9(8)15-2)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
| Регистрационный номер CAS |
60075-23-2 |
| Молекулярная структура |
|
| Плотность |
1.168g/cm3 |
| Точка кипения |
420.3°C at 760 mmHg |
| Показатель преломления |
1.538 |
| Температура вспышки |
208°C |
| Давление пара |
2.84E-07mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
