ChemNet > CAS > 602-87-9 5-Nitroacenaphthene
602-87-9 5-Nitroacenaphthene
| Название продукта |
5-Nitroacenaphthene |
| Английское название |
5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene; 4-05-00-01840 (Beilstein Handbook Reference); 5-Nan; 5-Nitroacenaphthylene; 5-Nitroacenapthene; 5-Nitronaphthalene; 5-Nitronaphthalene ethylene; Acenaphthene, 5-nitro-; Acenaphthylene, 1,2-dihydro-5-nitro-; BRN 1876864; CCRIS 438; HSDB 4092; NCI-C01967; NSC 1312; NSC 22421; 1,2-Dihydro-5-nitroacenaphthylene; 5-nitro-1,2-dihydroacenaphthylene; Nitroacenaphthene; 1,2-dihydro-5-nitro-acenaphthylen |
| Молекулярная формула |
C12H7NO2 |
| Молекулярный вес |
197.1895 |
| InChI |
InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| Регистрационный номер CAS |
602-87-9 |
| EINECS |
210-025-0 |
| Молекулярная структура |
|
| Плотность |
1.408g/cm3 |
| Температура плавления |
101-102℃ |
| Точка кипения |
381.6°C at 760 mmHg |
| Показатель преломления |
1.763 |
| Температура вспышки |
196.7°C |
| Давление пара |
1.1E-05mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R45:May cause cancer.;
|
| Характеристики безопасности |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
