ChemNet > CAS > 60404-18-4 3-Bromo-2,5-dichlorothiophene
60404-18-4 3-Bromo-2,5-dichlorothiophene
| Название продукта |
3-Bromo-2,5-dichlorothiophene |
| Английское название |
3-Bromo-2,5-dichlorothiophene; |
| Молекулярная формула |
C4HBrCl2S |
| Молекулярный вес |
231.9257 |
| InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| Регистрационный номер CAS |
60404-18-4 |
| Молекулярная структура |
|
| Плотность |
1.949g/cm3 |
| Точка кипения |
223.1°C at 760 mmHg |
| Показатель преломления |
1.625 |
| Температура вспышки |
88.7°C |
| Давление пара |
0.146mmHg at 25°C |
| Символы опасности |
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
