613-13-8 2-Aminoanthracene
Название продукта |
2-Aminoanthracene |
Английское название |
2-Aminoanthracene; 2-anthramine practical grade*crystalline; 2-anthrylamine; 2-Anthramine; 2-Anthranamine; anthracen-2-amine; 2-Anthracenamide;
|
Молекулярная формула |
C14H11N |
Молекулярный вес |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
Регистрационный номер CAS |
613-13-8 |
EINECS |
210-330-9 |
Молекулярная структура |
|
Плотность |
1.208g/cm3 |
Температура плавления |
238-241℃ |
Точка кипения |
414.2°C at 760 mmHg |
Показатель преломления |
1.765 |
Температура вспышки |
229°C |
Давление пара |
4.52E-07mmHg at 25°C |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R33:Danger of cummulative effects.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|