ChemNet > CAS > 6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
Название продукта |
3,4-(Methylenedioxy)-6-nitrocinnamic acid |
Английское название |
3,4-(Methylenedioxy)-6-nitrocinnamic acid; (2Z)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
Молекулярная формула |
C10H6NO6 |
Молекулярный вес |
236.1583 |
InChI |
InChI=1/C10H7NO6/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15/h1-4H,5H2,(H,12,13)/p-1/b2-1+ |
Регистрационный номер CAS |
6315-90-8 |
Молекулярная структура |
|
Точка кипения |
452.3°C at 760 mmHg |
Температура вспышки |
227.3°C |
Давление пара |
5.73E-09mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36:Wear suitable protective clothing.;
|
|