ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
| Название продукта |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
| Английское название |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile;1-(4-Chlorophenyl)cyclohexanecarbonitrile |
| Молекулярная формула |
C13H14ClN |
| Молекулярный вес |
219.71 |
| InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
| Регистрационный номер CAS |
64399-28-6 |
| EINECS |
264-872-6 |
| Молекулярная структура |
|
| Плотность |
1.14g/cm3 |
| Температура плавления |
88-92℃ |
| Точка кипения |
350.5°C at 760 mmHg |
| Показатель преломления |
1.559 |
| Температура вспышки |
143.5°C |
| Давление пара |
4.38E-05mmHg at 25°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|
