ChemNet > CAS > 6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
Название продукта |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
Английское название |
2-Chloro-N-(2,6-diethylphenyl)-acetamide; N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
Молекулярная формула |
C12H16ClNO |
Молекулярный вес |
225.7145 |
InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
Регистрационный номер CAS |
6967-29-9 |
Молекулярная структура |
|
Плотность |
1.131g/cm3 |
Точка кипения |
369.2°C at 760 mmHg |
Показатель преломления |
1.559 |
Температура вспышки |
177.1°C |
Давление пара |
1.2E-05mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|