ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
Название продукта |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
Английское название |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
Молекулярная формула |
C14H8Cl4 |
Молекулярный вес |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
Регистрационный номер CAS |
72-55-9 |
EINECS |
200-784-6 |
Молекулярная структура |
|
Температура плавления |
87-90℃ |
Растворимость в воде |
0.00000013 g/100 mL |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|