ChemNet > CAS > 73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
Название продукта |
4,5-Dimethoxy-2-nitrophenylacetic acid |
Английское название |
4,5-Dimethoxy-2-nitrophenylacetic acid; 2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid; (4,5-dimethoxy-2-nitrophenyl)acetate |
Молекулярная формула |
C10H10NO6 |
Молекулярный вес |
240.19 |
InChI |
InChI=1/C10H11NO6/c1-16-8-3-6(4-10(12)13)7(11(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3,(H,12,13)/p-1 |
Регистрационный номер CAS |
73357-18-3 |
Молекулярная структура |
|
Температура плавления |
206-208℃ |
Точка кипения |
433.4°C at 760 mmHg |
Температура вспышки |
215.9°C |
Давление пара |
2.79E-08mmHg at 25°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|