ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
Название продукта |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
Английское название |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo; 5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
Молекулярная формула |
C8H14ClNO2 |
Молекулярный вес |
191.6553 |
InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
Регистрационный номер CAS |
81074-81-9 |
EINECS |
279-686-0 |
Молекулярная структура |
|
Температура плавления |
122-125℃ |
Точка кипения |
217.7°C at 760 mmHg |
Температура вспышки |
85.5°C |
Давление пара |
0.0762mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|