ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
Название продукта |
Methyl 3-methylthiophene-2-carboxylate |
Английское название |
Methyl 3-methylthiophene-2-carboxylate; 3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
Молекулярная формула |
C7H8O2S |
Молекулярный вес |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
Регистрационный номер CAS |
81452-54-2 |
Молекулярная структура |
|
Плотность |
1.173g/cm3 |
Точка кипения |
211°C at 760 mmHg |
Показатель преломления |
1.531 |
Температура вспышки |
81.4°C |
Давление пара |
0.186mmHg at 25°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|