823-76-7 Cyclohexyl methyl ketone
Название продукта |
Cyclohexyl methyl ketone |
Английское название |
Cyclohexyl methyl ketone; Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
Молекулярная формула |
C8H14O |
Молекулярный вес |
126.1962 |
InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
Регистрационный номер CAS |
823-76-7 |
EINECS |
212-517-0 |
Молекулярная структура |
|
Плотность |
0.916g/cm3 |
Точка кипения |
181.5°C at 760 mmHg |
Показатель преломления |
1.448 |
Температура вспышки |
61.4°C |
Давление пара |
0.849mmHg at 25°C |
Символы опасности |
|
Риск коды |
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|