100-80-1 m-Vinyltoluene
اسم المنتج |
m-Vinyltoluene |
الاسم بالانجليزية |
m-Vinyltoluene; 3-Methylstyrene; 3-Vinyltoluene |
الصيغة الجزيئية |
C9H10 |
الوزن الجزيئي الغرامي |
118.17 |
InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
إستراتيجية المساعدة القطرية |
100-80-1 |
المفوضية الأوروبية رقم |
202-889-2 |
بنية جزيئية |
|
كثافة |
170 |
نقطة الغليان |
171℃ |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|