ChemNet > CAS > 10047-28-6 butyl thioglycolate
10047-28-6 butyl thioglycolate
| اسم المنتج |
butyl thioglycolate |
| الاسم بالانجليزية |
butyl thioglycolate; |
| الصيغة الجزيئية |
C6H12O2S |
| الوزن الجزيئي الغرامي |
148.2233 |
| InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| إستراتيجية المساعدة القطرية |
10047-28-6 |
| المفوضية الأوروبية رقم |
233-156-5 |
| بنية جزيئية |
|
| كثافة |
1.088g/cm3 |
| نقطة الغليان |
220.125°C at 760 mmHg |
| معامل الإنكسار |
1.491 |
| نقطة الوميض |
86.929°C |
| ضغط البخار |
0.024mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
