ChemNet > CAS > 104-18-7 (4-Aminophenylthio)acetic acid
104-18-7 (4-Aminophenylthio)acetic acid
اسم المنتج |
(4-Aminophenylthio)acetic acid |
الاسم بالانجليزية |
(4-Aminophenylthio)acetic acid; 2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
الصيغة الجزيئية |
C8H8NO2S |
الوزن الجزيئي الغرامي |
182.2202 |
InChI |
InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
إستراتيجية المساعدة القطرية |
104-18-7 |
المفوضية الأوروبية رقم |
203-182-1 |
بنية جزيئية |
|
نقطة الغليان |
405.3°C at 760 mmHg |
نقطة الوميض |
198.9°C |
ضغط البخار |
2.69E-07mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|