10502-44-0 4-methoxymandelic acid
اسم المنتج |
4-methoxymandelic acid |
الاسم بالانجليزية |
4-methoxymandelic acid; alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
الصيغة الجزيئية |
C9H10O4 |
الوزن الجزيئي الغرامي |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
إستراتيجية المساعدة القطرية |
10502-44-0 |
المفوضية الأوروبية رقم |
234-031-8 |
بنية جزيئية |
|
كثافة |
1.309g/cm3 |
درجة الإنصهار |
108-111℃ |
نقطة الغليان |
370.4°C at 760 mmHg |
معامل الإنكسار |
1.569 |
نقطة الوميض |
152.6°C |
ضغط البخار |
3.86E-06mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|