ChemNet > CAS > 10595-06-9 2-Phenoxyethyl methacrylate
10595-06-9 2-Phenoxyethyl methacrylate
| اسم المنتج |
2-Phenoxyethyl methacrylate |
| الاسم بالانجليزية |
2-Phenoxyethyl methacrylate; |
| الصيغة الجزيئية |
C12H14O3 |
| الوزن الجزيئي الغرامي |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| إستراتيجية المساعدة القطرية |
10595-06-9 |
| المفوضية الأوروبية رقم |
234-201-1 |
| بنية جزيئية |
|
| كثافة |
1.059g/cm3 |
| نقطة الغليان |
292.352°C at 760 mmHg |
| معامل الإنكسار |
1.501 |
| نقطة الوميض |
118.277°C |
| ضغط البخار |
0.002mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
