ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
اسم المنتج |
ethyl (R)-(-)-mandelate |
الاسم بالانجليزية |
ethyl (R)-(-)-mandelate; (-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
الصيغة الجزيئية |
C10H12O3 |
الوزن الجزيئي الغرامي |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
إستراتيجية المساعدة القطرية |
10606-72-1 |
بنية جزيئية |
|
كثافة |
1.147g/cm3 |
درجة الإنصهار |
33-34℃ |
نقطة الغليان |
254°C at 760 mmHg |
معامل الإنكسار |
1.528 |
نقطة الوميض |
118.1°C |
ضغط البخار |
0.00918mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|