1073-29-6 2-Hydroxythioanisole
اسم المنتج |
2-Hydroxythioanisole |
الاسم بالانجليزية |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
الصيغة الجزيئية |
C7H8OS |
الوزن الجزيئي الغرامي |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
إستراتيجية المساعدة القطرية |
1073-29-6 |
المفوضية الأوروبية رقم |
214-027-2 |
بنية جزيئية |
|
كثافة |
1.19g/cm3 |
نقطة الغليان |
206.1°C at 760 mmHg |
معامل الإنكسار |
1.613 |
نقطة الوميض |
108°C |
ضغط البخار |
0.168mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|