111373-03-6 Cyanophenylpiperazine
اسم المنتج |
Cyanophenylpiperazine |
الاسم بالانجليزية |
Cyanophenylpiperazine; 1-(2-Cyanophenyl)piperazine; 2-(1-Piperazino)benzonitrile; 2-piperazin-1-ylbenzonitrile |
الصيغة الجزيئية |
C11H13N3 |
الوزن الجزيئي الغرامي |
187.241 |
InChI |
InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
إستراتيجية المساعدة القطرية |
111373-03-6 |
بنية جزيئية |
|
كثافة |
1.16g/cm3 |
نقطة الغليان |
369.4°C at 760 mmHg |
معامل الإنكسار |
1.602 |
نقطة الوميض |
177.2°C |
ضغط البخار |
1.19E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|