1129-35-7 methyl 4-cyanobenzoate
اسم المنتج |
methyl 4-cyanobenzoate |
الاسم بالانجليزية |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
الصيغة الجزيئية |
C9H7NO2 |
الوزن الجزيئي الغرامي |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
إستراتيجية المساعدة القطرية |
1129-35-7 |
المفوضية الأوروبية رقم |
214-443-4 |
بنية جزيئية |
|
كثافة |
1.18g/cm3 |
درجة الإنصهار |
62℃ |
نقطة الغليان |
274.9°C at 760 mmHg |
معامل الإنكسار |
1.535 |
نقطة الوميض |
131.2°C |
ضغط البخار |
0.00526mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|