116632-39-4 Bromoiodotoluene
اسم المنتج |
Bromoiodotoluene |
الاسم بالانجليزية |
Bromoiodotoluene; 5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
الصيغة الجزيئية |
C7H6BrI |
الوزن الجزيئي الغرامي |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
116632-39-4 |
بنية جزيئية |
|
كثافة |
2.062g/cm3 |
نقطة الغليان |
264.2°C at 760 mmHg |
معامل الإنكسار |
1.636 |
نقطة الوميض |
113.6°C |
ضغط البخار |
0.0161mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|