1186-52-3 Acetic-d3 acid-d
اسم المنتج |
Acetic-d3 acid-d |
الاسم بالانجليزية |
Acetic-d3 acid-d; |
الصيغة الجزيئية |
C2D4O2 |
الوزن الجزيئي الغرامي |
64.0766 |
InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
إستراتيجية المساعدة القطرية |
1186-52-3 |
المفوضية الأوروبية رقم |
214-693-4 |
بنية جزيئية |
|
كثافة |
1.14g/cm3 |
درجة الإنصهار |
15-16℃ |
نقطة الغليان |
117.1°C at 760 mmHg |
معامل الإنكسار |
1.375 |
نقطة الوميض |
40°C |
ضغط البخار |
13.9mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R10:Flammable.;
R35:Causes severe burns.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|