ChemNet > CAS > 129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
اسم المنتج |
2-(8-Chloro-1-naphthylthio)acetic acid |
الاسم بالانجليزية |
2-(8-Chloro-1-naphthylthio)acetic acid; 2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
الصيغة الجزيئية |
C12H8ClO2S |
الوزن الجزيئي الغرامي |
251.7093 |
InChI |
InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
إستراتيجية المساعدة القطرية |
129-94-2 |
المفوضية الأوروبية رقم |
204-971-3 |
بنية جزيئية |
|
درجة الإنصهار |
155-157℃ |
نقطة الغليان |
450.1°C at 760 mmHg |
نقطة الوميض |
226°C |
ضغط البخار |
6.9E-09mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|