13221-86-8 2,4-Dihydroxybenzhydrazide

اسم المنتج	2,4-Dihydroxybenzhydrazide
الاسم بالانجليزية	2,4-Dihydroxybenzhydrazide; 2,4-Dihydroxybenzoic acid,hydrazide; 2,4-dihydroxybenzohydrazide
الصيغة الجزيئية	C₇H₈N₂O₃
الوزن الجزيئي الغرامي	168.15
InChI	InChI=1/C7H8N2O3/c8-9-7(12)5-2-1-4(10)3-6(5)11/h1-3,10-11H,8H2,(H,9,12)
إستراتيجية المساعدة القطرية	13221-86-8
بنية جزيئية
كثافة	1.477g/cm³
درجة الإنصهار	247-250℃
معامل الإنكسار	1.67
علامات على البضائع الخطرة
خطر المصطلحات	R36/37/38:Irritating to eyes, respiratory system and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;