133-49-3 Penta-Chloro Thiophenol
اسم المنتج |
Penta-Chloro Thiophenol |
الاسم بالانجليزية |
Penta-Chloro Thiophenol; Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
الصيغة الجزيئية |
C6HCl5S |
الوزن الجزيئي الغرامي |
282.4021 |
InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
إستراتيجية المساعدة القطرية |
133-49-3 |
المفوضية الأوروبية رقم |
205-107-8 |
بنية جزيئية |
|
كثافة |
1.745g/cm3 |
درجة الإنصهار |
223-227℃ |
نقطة الغليان |
351.3°C at 760 mmHg |
معامل الإنكسار |
1.648 |
نقطة الوميض |
144.6°C |
ضغط البخار |
8.41E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/22:Harmful by inhalation and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|