ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
اسم المنتج |
Dimethyl 3-nitrophthalate |
الاسم بالانجليزية |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
الصيغة الجزيئية |
C10H9NO6 |
الوزن الجزيئي الغرامي |
239.1816 |
InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
إستراتيجية المساعدة القطرية |
13365-26-9 |
بنية جزيئية |
|
كثافة |
1.35g/cm3 |
نقطة الغليان |
314.6°C at 760 mmHg |
معامل الإنكسار |
1.549 |
نقطة الوميض |
134.3°C |
ضغط البخار |
0.000462mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|