ChemNet > CAS > 13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
اسم المنتج |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol |
الاسم بالانجليزية |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol;alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol; 2-chloro-1-(2,4-dichlorophenyl)ethanol; (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol; (1R)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
الصيغة الجزيئية |
C8H7Cl3O |
الوزن الجزيئي الغرامي |
225.4996 |
InChI |
InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
إستراتيجية المساعدة القطرية |
13692-14-3 |
المفوضية الأوروبية رقم |
237-206-7 |
بنية جزيئية |
|
كثافة |
1.447g/cm3 |
درجة الإنصهار |
48-52℃ |
نقطة الغليان |
323.3°C at 760 mmHg |
معامل الإنكسار |
1.581 |
نقطة الوميض |
149.3°C |
ضغط البخار |
0.000109mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|