ChemNet > CAS > 137577-00-5 2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone
137577-00-5 2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone
| اسم المنتج |
2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone |
| الاسم بالانجليزية |
2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone;2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)ethanone |
| الصيغة الجزيئية |
C12H11BrN2O |
| الوزن الجزيئي الغرامي |
279.1325 |
| InChI |
InChI=1/C12H11BrN2O/c1-9-11(12(16)7-13)8-14-15(9)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| إستراتيجية المساعدة القطرية |
137577-00-5 |
| بنية جزيئية |
|
| كثافة |
1.44g/cm3 |
| درجة الإنصهار |
93℃ |
| نقطة الغليان |
373.1°C at 760 mmHg |
| معامل الإنكسار |
1.621 |
| نقطة الوميض |
179.5°C |
| ضغط البخار |
9.16E-06mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
