ChemNet > CAS > 13991-08-7 1,2-Bis(dimethylphosphino)benzene
13991-08-7 1,2-Bis(dimethylphosphino)benzene
اسم المنتج |
1,2-Bis(dimethylphosphino)benzene |
الاسم بالانجليزية |
1,2-Bis(dimethylphosphino)benzene; 1,2-Bis(diphenylphosphino)benzene; benzene-1,2-diylbis(diphenylphosphane) |
الصيغة الجزيئية |
C30H24P2 |
الوزن الجزيئي الغرامي |
446.4591 |
InChI |
InChI=1/C30H24P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H |
إستراتيجية المساعدة القطرية |
13991-08-7 |
بنية جزيئية |
|
درجة الإنصهار |
185-187℃ |
نقطة الغليان |
546.942°C at 760 mmHg |
نقطة الوميض |
302.787°C |
ضغط البخار |
0mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|