ChemNet > CAS > 1501-27-5 mono-methyl glutarate
1501-27-5 mono-methyl glutarate
| اسم المنتج |
mono-methyl glutarate |
| الاسم بالانجليزية |
mono-methyl glutarate; Methyl hydrogen glutarate; Glutaric acid monomethyl ester; Monomethyl glutarate; Pentanedioic acid monomethyl ester; Monoethyl Glutaric Acid; 5-methoxy-5-oxopentanoic acid; 5-methoxy-5-oxopentanoate; 5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
| الصيغة الجزيئية |
C15H26O4 |
| الوزن الجزيئي الغرامي |
270.3645 |
| InChI |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
| إستراتيجية المساعدة القطرية |
1501-27-5 |
| المفوضية الأوروبية رقم |
216-116-1 |
| بنية جزيئية |
|
| كثافة |
1.05g/cm3 |
| نقطة الغليان |
393.406°C at 760 mmHg |
| معامل الإنكسار |
1.478 |
| نقطة الوميض |
137.448°C |
| ضغط البخار |
0mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
| شروط الأمن |
S23:;
S24/25:;
|
|
