ChemNet > CAS > 15356-60-2 D-Menthol
15356-60-2 D-Menthol
| اسم المنتج |
D-Menthol |
| الاسم بالانجليزية |
D-Menthol; (1S,2R,5S)-(+)-Menthol; (1S,2R,5S)-2-Isopropyl-5-methylcyclohexanol; (1S,2R,5S)-5-methyl-2-(propan-2-yl)cyclohexanol; (1S,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanol; (+)-menthol |
| الصيغة الجزيئية |
C10H20O |
| الوزن الجزيئي الغرامي |
156.2652 |
| InChI |
InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| إستراتيجية المساعدة القطرية |
15356-60-2 |
| المفوضية الأوروبية رقم |
239-387-8 |
| بنية جزيئية |
|
| كثافة |
0.89g/cm3 |
| درجة الإنصهار |
43-44℃ |
| نقطة الغليان |
215.4°C at 760 mmHg |
| معامل الإنكسار |
1.457 |
| نقطة الوميض |
93.3°C |
| ضغط البخار |
0.0323mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R37/38:Irritating to respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
