1556-18-9 Iodocyclopentane
اسم المنتج |
Iodocyclopentane |
الاسم بالانجليزية |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
الصيغة الجزيئية |
C8H7NOS |
الوزن الجزيئي الغرامي |
165.2123 |
InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
إستراتيجية المساعدة القطرية |
1556-18-9 |
المفوضية الأوروبية رقم |
216-311-1 |
بنية جزيئية |
|
كثافة |
1.08g/cm3 |
نقطة الغليان |
280.5°C at 760 mmHg |
معامل الإنكسار |
1.551 |
نقطة الوميض |
123.4°C |
ضغط البخار |
0.00642mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|