ChemNet > CAS > 157373-08-5 2,3,4-trifluorobenzoyl chloride
157373-08-5 2,3,4-trifluorobenzoyl chloride
| اسم المنتج |
2,3,4-trifluorobenzoyl chloride |
| الاسم بالانجليزية |
2,3,4-trifluorobenzoyl chloride; |
| الصيغة الجزيئية |
C7H2ClF3O |
| الوزن الجزيئي الغرامي |
194.5384 |
| InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
| إستراتيجية المساعدة القطرية |
157373-08-5 |
| بنية جزيئية |
|
| كثافة |
1.514g/cm3 |
| نقطة الغليان |
203.2°C at 760 mmHg |
| معامل الإنكسار |
1.479 |
| نقطة الوميض |
60.4°C |
| ضغط البخار |
0.28mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
