ChemNet > CAS > 157664-47-6 (2-bromo-3-thienyl)methylamine
157664-47-6 (2-bromo-3-thienyl)methylamine
| اسم المنتج |
(2-bromo-3-thienyl)methylamine |
| الاسم بالانجليزية |
(2-bromo-3-thienyl)methylamine;1-(2-bromothiophen-3-yl)methanamine; 1-(2-bromothiophen-3-yl)methanamine hydrochloride; 2-bromo-3-thiophenemethylamine;
|
| الصيغة الجزيئية |
C5H7BrClNS |
| الوزن الجزيئي الغرامي |
228.5378 |
| InChI |
InChI=1/C5H6BrNS.ClH/c6-5-4(3-7)1-2-8-5;/h1-2H,3,7H2;1H |
| إستراتيجية المساعدة القطرية |
157664-47-6 |
| بنية جزيئية |
|
| نقطة الغليان |
244.7°C at 760 mmHg |
| نقطة الوميض |
101.8°C |
| ضغط البخار |
0.03mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
