ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
| اسم المنتج |
octanoic acid, compound with dicyclohexylamine (1:1) |
| الاسم بالانجليزية |
octanoic acid, compound with dicyclohexylamine (1:1); Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
| الصيغة الجزيئية |
C20H39NO2 |
| الوزن الجزيئي الغرامي |
325.5292 |
| InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
| إستراتيجية المساعدة القطرية |
15816-71-4 |
| المفوضية الأوروبية رقم |
239-914-1 |
| بنية جزيئية |
|
| نقطة الغليان |
466.8°C at 760 mmHg |
| نقطة الوميض |
236.1°C |
| ضغط البخار |
5.25E-10mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
