ChemNet > CAS > 158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
| اسم المنتج |
4-Amino-3-chloro-5-methylbenzonitrile |
| الاسم بالانجليزية |
4-Amino-3-chloro-5-methylbenzonitrile; 2-Chloro-4-cyano-6-methylaniline |
| الصيغة الجزيئية |
C8H7ClN2 |
| الوزن الجزيئي الغرامي |
166.6076 |
| InChI |
InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| إستراتيجية المساعدة القطرية |
158296-69-6 |
| بنية جزيئية |
|
| كثافة |
1.27g/cm3 |
| نقطة الغليان |
302°C at 760 mmHg |
| معامل الإنكسار |
1.594 |
| نقطة الوميض |
136.5°C |
| ضغط البخار |
0.00102mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
