ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
اسم المنتج |
Cyclohexanone 2,4-dinitrophenylhydrazone |
الاسم بالانجليزية |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
الصيغة الجزيئية |
C12H14N4O4 |
الوزن الجزيئي الغرامي |
278.264 |
InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
إستراتيجية المساعدة القطرية |
1589-62-4 |
المفوضية الأوروبية رقم |
216-458-1 |
بنية جزيئية |
|
كثافة |
1.47g/cm3 |
درجة الإنصهار |
159-161℃ |
نقطة الغليان |
434.6°C at 760 mmHg |
معامل الإنكسار |
1.665 |
نقطة الوميض |
216.7°C |
ضغط البخار |
9.33E-08mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|