1631-83-0 Diphenylchlorosilane

اسم المنتج	Diphenylchlorosilane
الاسم بالانجليزية	Diphenylchlorosilane; Chlorodiphenylsilane; chloro(diphenyl)silyl
الصيغة الجزيئية	C₁₂H₁₀ClSi
الوزن الجزيئي الغرامي	217.7463
InChI	InChI=1/C12H10ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
إستراتيجية المساعدة القطرية	1631-83-0
المفوضية الأوروبية رقم	216-634-8
بنية جزيئية
علامات على البضائع الخطرة
خطر المصطلحات	R34:Causes burns.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;