ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
اسم المنتج |
5-fluoro-2-methylphenylboronic acid |
الاسم بالانجليزية |
5-fluoro-2-methylphenylboronic acid; 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
الصيغة الجزيئية |
C7H8BFO2 |
الوزن الجزيئي الغرامي |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
إستراتيجية المساعدة القطرية |
163517-62-2 |
بنية جزيئية |
|
كثافة |
1.2g/cm3 |
نقطة الغليان |
287.7°C at 760 mmHg |
معامل الإنكسار |
1.505 |
نقطة الوميض |
127.8°C |
ضغط البخار |
0.00113mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|