ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
| اسم المنتج |
Ethyl 5-methylindole-2-carboxylate |
| الاسم بالانجليزية |
Ethyl 5-methylindole-2-carboxylate; 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| الصيغة الجزيئية |
C12H13NO2 |
| الوزن الجزيئي الغرامي |
203.2371 |
| InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
16382-15-3 |
| بنية جزيئية |
|
| كثافة |
1.177g/cm3 |
| نقطة الغليان |
356.5°C at 760 mmHg |
| معامل الإنكسار |
1.609 |
| نقطة الوميض |
169.4°C |
| ضغط البخار |
2.9E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
