ChemNet > CAS > 1641-40-3 o-Phenylene phosphorochloridite
1641-40-3 o-Phenylene phosphorochloridite
| اسم المنتج |
o-Phenylene phosphorochloridite |
| الاسم بالانجليزية |
o-Phenylene phosphorochloridite; 1,2-Phenylene phosphorochloridite; Catechyl phosphorus chloride; 2-Chloro-1,3,2-benzodioxaphosphole; phosphorochloridous acid, 1,2-phenylene ester, ion(1-) |
| الصيغة الجزيئية |
C6H5Cl2O4P2 |
| الوزن الجزيئي الغرامي |
273.9556 |
| InChI |
InChI=1/C6H5Cl2O4P2/c7-13(9)11-5-3-1-2-4-6(5)12-14(8)10/h1-4,9H/q-1 |
| إستراتيجية المساعدة القطرية |
1641-40-3 |
| المفوضية الأوروبية رقم |
216-690-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
30-81℃ |
| نقطة الغليان |
395.388°C at 760 mmHg |
| نقطة الوميض |
192.924°C |
| ضغط البخار |
0mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
