ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| اسم المنتج |
5-Nitrothiophene-2-carbonitrile |
| الاسم بالانجليزية |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
| الصيغة الجزيئية |
C5H2N2O2S |
| الوزن الجزيئي الغرامي |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| إستراتيجية المساعدة القطرية |
16689-02-4 |
| بنية جزيئية |
|
| كثافة |
1.5g/cm3 |
| نقطة الغليان |
273.9°C at 760 mmHg |
| معامل الإنكسار |
1.611 |
| نقطة الوميض |
119.4°C |
| ضغط البخار |
0.00558mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
