ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
اسم المنتج |
4-Amino-3-ethylbenzonitrile |
الاسم بالانجليزية |
4-Amino-3-ethylbenzonitrile; 4-Cyano-2-ethylaniline |
الصيغة الجزيئية |
C9H10N2 |
الوزن الجزيئي الغرامي |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
إستراتيجية المساعدة القطرية |
170230-87-2 |
بنية جزيئية |
|
كثافة |
1.07g/cm3 |
نقطة الغليان |
297.1°C at 760 mmHg |
معامل الإنكسار |
1.562 |
نقطة الوميض |
133.5°C |
ضغط البخار |
0.00138mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|