ChemNet > CAS > 17277-58-6 Methyl (phenylthio)acetate
17277-58-6 Methyl (phenylthio)acetate
| اسم المنتج |
Methyl (phenylthio)acetate |
| الاسم بالانجليزية |
Methyl (phenylthio)acetate; Methyl (phenylmercapto)acetate~(Phenylthio)acetic acid methyl ester; methyl (phenylsulfanyl)acetate |
| الصيغة الجزيئية |
C9H10O2S |
| الوزن الجزيئي الغرامي |
182.2395 |
| InChI |
InChI=1/C9H10O2S/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| إستراتيجية المساعدة القطرية |
17277-58-6 |
| بنية جزيئية |
|
| كثافة |
1.16g/cm3 |
| نقطة الغليان |
259.3°C at 760 mmHg |
| معامل الإنكسار |
1.556 |
| نقطة الوميض |
115.3°C |
| ضغط البخار |
0.013mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
