ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
اسم المنتج |
6-methoxypyridine-3-carbothioamide |
الاسم بالانجليزية |
6-methoxypyridine-3-carbothioamide; 6-methoxy-3-Pyridinecarbothioamide |
الصيغة الجزيئية |
C7H8N2OS |
الوزن الجزيئي الغرامي |
168.2162 |
InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
إستراتيجية المساعدة القطرية |
175277-49-3 |
بنية جزيئية |
|
كثافة |
1.262g/cm3 |
درجة الإنصهار |
150℃ |
نقطة الغليان |
292.5°C at 760 mmHg |
معامل الإنكسار |
1.626 |
نقطة الوميض |
130.7°C |
ضغط البخار |
0.00183mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|