ChemNet > CAS > 17700-09-3 2,3,4-Trichloronitrobenzene
17700-09-3 2,3,4-Trichloronitrobenzene
| اسم المنتج |
2,3,4-Trichloronitrobenzene |
| الاسم بالانجليزية |
2,3,4-Trichloronitrobenzene; 1-Nitro-2,3,4-trichlorobenzene; 2,3,4-trichloronitrobenzole; 1,2,3-trichloro-4-nitrobenzene |
| الصيغة الجزيئية |
C6H2Cl3NO2 |
| الوزن الجزيئي الغرامي |
226.4446 |
| InChI |
InChI=1/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| إستراتيجية المساعدة القطرية |
17700-09-3 |
| المفوضية الأوروبية رقم |
241-705-5 |
| بنية جزيئية |
|
| كثافة |
1.651g/cm3 |
| درجة الإنصهار |
55-56℃ |
| نقطة الغليان |
296.2°C at 760 mmHg |
| معامل الإنكسار |
1.609 |
| نقطة الوميض |
133°C |
| ضغط البخار |
0.00256mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| شروط الأمن |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
