ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
| اسم المنتج |
adamantane-1-carbohydrazide |
| الاسم بالانجليزية |
adamantane-1-carbohydrazide; tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
| الصيغة الجزيئية |
C11H18N2O |
| الوزن الجزيئي الغرامي |
194.2734 |
| InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
| إستراتيجية المساعدة القطرية |
17846-15-0 |
| بنية جزيئية |
|
| كثافة |
1.203g/cm3 |
| درجة الإنصهار |
157℃ |
| نقطة الغليان |
370.8°C at 760 mmHg |
| معامل الإنكسار |
1.581 |
| نقطة الوميض |
178°C |
| ضغط البخار |
1.08E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
