ChemNet > CAS > 18362-64-6 2,6-Dimethyl-3,5-heptanedione
18362-64-6 2,6-Dimethyl-3,5-heptanedione
| اسم المنتج |
2,6-Dimethyl-3,5-heptanedione |
| الاسم بالانجليزية |
2,6-Dimethyl-3,5-heptanedione;2,6-dimethylheptane-3,5-dione; (4Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
| الصيغة الجزيئية |
C9H16O2 |
| الوزن الجزيئي الغرامي |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
| إستراتيجية المساعدة القطرية |
18362-64-6 |
| المفوضية الأوروبية رقم |
242-234-8 |
| بنية جزيئية |
|
| كثافة |
0.941g/cm3 |
| نقطة الغليان |
239.2°C at 760 mmHg |
| معامل الإنكسار |
1.456 |
| نقطة الوميض |
97.8°C |
| ضغط البخار |
0.00713mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
